C20H26O2S — CID 174315117
(8S,11R,13S,14S)-13-methyl-11-(2-sulfanylethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 174315117) has the molecular formula C20H26O2S and a molecular weight of 330.49 g/mol. Its IUPAC name is (8S,11R,13S,14S)-13-methyl-11-(2-sulfanylethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8S,11R,13S,14S)-13-methyl-11-(2-sulfanylethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 174315117 |
| Molecular Formula | C20H26O2S |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (8S,11R,13S,14S)-13-methyl-11-(2-sulfanylethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12C[C@H](CCS)C3=C4CCC(=O)C=C4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C20H26O2S/c1-20-11-13(8-9-23)19-15-5-3-14(21)10-12(15)2-4-16(19)17(20)6-7-18(20)22/h10,13,16-17,23H,2-9,11H2,1H3/t13-,16-,17-,20-/m0/s1 |
| InChIKey | CYLSKIUCALKOSM-FDRFZEDHSA-N |
| XLogP | 4.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|