C20H28O — CID 170027256
11,13,17-trimethyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 170027256) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is 11,13,17-trimethyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 11,13,17-trimethyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 170027256 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 11,13,17-trimethyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC1CC2(C)C(C)CCC2C2CCC3=CC(=O)CCC3=C12 |
| InChI | InChI=1S/C20H28O/c1-12-11-20(3)13(2)4-9-18(20)17-7-5-14-10-15(21)6-8-16(14)19(12)17/h10,12-13,17-18H,4-9,11H2,1-3H3 |
| InChIKey | KPJJWPKJAWCFNS-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |