C26H31O5P — CID 143531191
(8S,11R,13S)-11-(4-dimethoxyphosphorylphenyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 143531191) has the molecular formula C26H31O5P and a molecular weight of 454.50 g/mol. Its IUPAC name is (8S,11R,13S)-11-(4-dimethoxyphosphorylphenyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8S,11R,13S)-11-(4-dimethoxyphosphorylphenyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 143531191 |
| Molecular Formula | C26H31O5P |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | (8S,11R,13S)-11-(4-dimethoxyphosphorylphenyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | COP(=O)(OC)c1ccc([C@H]2C[C@]3(C)C(=O)CCC3[C@@H]3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C26H31O5P/c1-26-15-22(16-4-8-19(9-5-16)32(29,30-2)31-3)25-20-11-7-18(27)14-17(20)6-10-21(25)23(26)12-13-24(26)28/h4-5,8-9,14,21-23H,6-7,10-13,15H2,1-3H3/t21-,22+,23?,26-/m0/s1 |
| InChIKey | LBBXLZZSGADLSI-VHNCWIJGSA-N |
| XLogP | 5.27 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|