C32H43NO5 — CID 166488288
tert-butyl N-methyl-N-[4-(13-methyl-17-oxospiro[1,2,4,5,6,7,8,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-11-yl)phenyl]carbamate (PubChem CID 166488288) has the molecular formula C32H43NO5 and a molecular weight of 521.70 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[4-(13-methyl-17-oxospiro[1,2,4,5,6,7,8,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-11-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[4-(13-methyl-17-oxospiro[1,2,4,5,6,7,8,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-11-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 166488288 |
| Molecular Formula | C32H43NO5 |
| Molecular Weight | 521.70 g/mol |
| Exact Mass | 521.31 |
| IUPAC Name | tert-butyl N-methyl-N-[4-(13-methyl-17-oxospiro[1,2,4,5,6,7,8,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-11-yl)phenyl]carbamate |
| SMILES | CN(C(=O)OC(C)(C)C)c1ccc(C2CC3(C)C(=O)CCC3C3CCC4CC5(CCC4=C23)OCCO5)cc1 |
| InChI | InChI=1S/C32H43NO5/c1-30(2,3)38-29(35)33(5)22-9-6-20(7-10-22)25-19-31(4)26(12-13-27(31)34)24-11-8-21-18-32(36-16-17-37-32)15-14-23(21)28(24)25/h6-7,9-10,21,24-26H,8,11-19H2,1-5H3 |
| InChIKey | XLUVQBKLNMPCSB-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.70 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|