C31H32O3 — CID 139648830
(8S,11R,13S,14S)-11-(4-hydroxyphenyl)-13-methyl-3-phenylmethoxy-6,7,8,11,12,14,15,16-octahydro-5H-cyclopenta[a]phenanthren-17-one (PubChem CID 139648830) has the molecular formula C31H32O3 and a molecular weight of 452.59 g/mol. Its IUPAC name is (8S,11R,13S,14S)-11-(4-hydroxyphenyl)-13-methyl-3-phenylmethoxy-6,7,8,11,12,14,15,16-octahydro-5H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8S,11R,13S,14S)-11-(4-hydroxyphenyl)-13-methyl-3-phenylmethoxy-6,7,8,11,12,14,15,16-octahydro-5H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 139648830 |
| Molecular Formula | C31H32O3 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | (8S,11R,13S,14S)-11-(4-hydroxyphenyl)-13-methyl-3-phenylmethoxy-6,7,8,11,12,14,15,16-octahydro-5H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12C[C@H](c3ccc(O)cc3)C3=C4C=CC(OCc5ccccc5)=CC4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C31H32O3/c1-31-18-27(21-7-10-23(32)11-8-21)30-25-14-12-24(34-19-20-5-3-2-4-6-20)17-22(25)9-13-26(30)28(31)15-16-29(31)33/h2-8,10-12,14,17,22,26-28,32H,9,13,15-16,18-19H2,1H3/t22?,26-,27+,28-,31-/m0/s1 |
| InChIKey | LYGQTGVCPLRRGS-SCYBXGQUSA-N |
| XLogP | 6.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |