C26H28BrClO3 — CID 11060216
(8S,11R,13S,14S)-11-[4-(2-bromoethoxy)phenyl]-4-chloro-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 11060216) has the molecular formula C26H28BrClO3 and a molecular weight of 503.86 g/mol. Its IUPAC name is (8S,11R,13S,14S)-11-[4-(2-bromoethoxy)phenyl]-4-chloro-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8S,11R,13S,14S)-11-[4-(2-bromoethoxy)phenyl]-4-chloro-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 11060216 |
| Molecular Formula | C26H28BrClO3 |
| Molecular Weight | 503.86 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | (8S,11R,13S,14S)-11-[4-(2-bromoethoxy)phenyl]-4-chloro-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12C[C@H](c3ccc(OCCBr)cc3)C3=C4CCC(=O)C(Cl)=C4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C26H28BrClO3/c1-26-14-20(15-2-4-16(5-3-15)31-13-12-27)24-17-8-10-22(29)25(28)18(17)6-7-19(24)21(26)9-11-23(26)30/h2-5,19-21H,6-14H2,1H3/t19-,20+,21-,26-/m0/s1 |
| InChIKey | FLWSGOOJXKBKMQ-LMMUWCHVSA-N |
| XLogP | 6.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.86 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|