C29H42INO3 — CID 153352596
15'-methyl-17'-[4-[methyl(propan-2-yl)amino]phenyl]spiro[1,3-dioxolane-2,5'-10λ3-iodatetracyclo[8.7.0.02,7.011,15]heptadec-1-ene]-14'-ol (PubChem CID 153352596) has the molecular formula C29H42INO3 and a molecular weight of 579.56 g/mol. Its IUPAC name is 15'-methyl-17'-[4-[methyl(propan-2-yl)amino]phenyl]spiro[1,3-dioxolane-2,5'-10λ3-iodatetracyclo[8.7.0.02,7.011,15]heptadec-1-ene]-14'-ol.
| Compound Name | 15'-methyl-17'-[4-[methyl(propan-2-yl)amino]phenyl]spiro[1,3-dioxolane-2,5'-10λ3-iodatetracyclo[8.7.0.02,7.011,15]heptadec-1-ene]-14'-ol |
|---|---|
| PubChem CID | 153352596 |
| Molecular Formula | C29H42INO3 |
| Molecular Weight | 579.56 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | 15'-methyl-17'-[4-[methyl(propan-2-yl)amino]phenyl]spiro[1,3-dioxolane-2,5'-10λ3-iodatetracyclo[8.7.0.02,7.011,15]heptadec-1-ene]-14'-ol |
| SMILES | CC(C)N(C)c1ccc(C2CC3(C)C(O)CCC3I3CCC4CC5(CCC4=C23)OCCO5)cc1 |
| InChI | InChI=1S/C29H42INO3/c1-19(2)31(4)22-7-5-20(6-8-22)24-18-28(3)25(9-10-26(28)32)30-14-12-21-17-29(33-15-16-34-29)13-11-23(21)27(24)30/h5-8,19,21,24-26,32H,9-18H2,1-4H3 |
| InChIKey | IYXKOLSRQAKPHD-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.56 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|