C27H42ClNO2 — CID 68738853
(1R,3S,5S,8R,9S,10S,13S,14S,17S)-1-[4-(dimethylamino)phenyl]-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol;hydrochloride (PubChem CID 68738853) has the molecular formula C27H42ClNO2 and a molecular weight of 448.09 g/mol. Its IUPAC name is (1R,3S,5S,8R,9S,10S,13S,14S,17S)-1-[4-(dimethylamino)phenyl]-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol;hydrochloride.
| Compound Name | (1R,3S,5S,8R,9S,10S,13S,14S,17S)-1-[4-(dimethylamino)phenyl]-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol;hydrochloride |
|---|---|
| PubChem CID | 68738853 |
| Molecular Formula | C27H42ClNO2 |
| Molecular Weight | 448.09 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | (1R,3S,5S,8R,9S,10S,13S,14S,17S)-1-[4-(dimethylamino)phenyl]-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol;hydrochloride |
| SMILES | CN(C)c1ccc([C@@H]2C[C@@](C)(O)C[C@@H]3CC[C@@H]4[C@H](CC[C@]5(C)[C@@H](O)CC[C@@H]45)[C@H]32)cc1.Cl |
| InChI | InChI=1S/C27H41NO2.ClH/c1-26(30)15-18-7-10-20-21(13-14-27(2)23(20)11-12-24(27)29)25(18)22(16-26)17-5-8-19(9-6-17)28(3)4;/h5-6,8-9,18,20-25,29-30H,7,10-16H2,1-4H3;1H/t18-,20+,21-,22-,23-,24-,25-,26-,27-;/m0./s1 |
| InChIKey | AKPPHCRLWYQROQ-IGCBASHJSA-N |
| XLogP | 5.63 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.09 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|