C21H32O — CID 154332393
(8S,9S,13R,14S)-3-methoxy-13,16,16-trimethyl-4,6,7,8,9,11,12,14,15,17-decahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 154332393) has the molecular formula C21H32O and a molecular weight of 300.49 g/mol. Its IUPAC name is (8S,9S,13R,14S)-3-methoxy-13,16,16-trimethyl-4,6,7,8,9,11,12,14,15,17-decahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (8S,9S,13R,14S)-3-methoxy-13,16,16-trimethyl-4,6,7,8,9,11,12,14,15,17-decahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 154332393 |
| Molecular Formula | C21H32O |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | (8S,9S,13R,14S)-3-methoxy-13,16,16-trimethyl-4,6,7,8,9,11,12,14,15,17-decahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | COC1=CCC2=C(CC[C@@H]3[C@@H]2CC[C@]2(C)CC(C)(C)C[C@@H]32)C1 |
| InChI | InChI=1S/C21H32O/c1-20(2)12-19-18-7-5-14-11-15(22-4)6-8-16(14)17(18)9-10-21(19,3)13-20/h6,17-19H,5,7-13H2,1-4H3/t17-,18-,19+,21-/m1/s1 |
| InChIKey | AWJUKLOJSXTHNX-WERVVEIQSA-N |
| XLogP | 5.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|