C22H32O2 — CID 67833479
(1R,2S,4S,6S,7S,10S)-6-ethoxy-14-methoxy-7-methylpentacyclo[8.8.0.02,7.04,6.011,16]octadeca-11(16),13-diene (PubChem CID 67833479) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is (1R,2S,4S,6S,7S,10S)-6-ethoxy-14-methoxy-7-methylpentacyclo[8.8.0.02,7.04,6.011,16]octadeca-11(16),13-diene.
| Compound Name | (1R,2S,4S,6S,7S,10S)-6-ethoxy-14-methoxy-7-methylpentacyclo[8.8.0.02,7.04,6.011,16]octadeca-11(16),13-diene |
|---|---|
| PubChem CID | 67833479 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (1R,2S,4S,6S,7S,10S)-6-ethoxy-14-methoxy-7-methylpentacyclo[8.8.0.02,7.04,6.011,16]octadeca-11(16),13-diene |
| SMILES | CCO[C@@]12C[C@@H]1C[C@H]1[C@@H]3CCC4=C(CC=C(OC)C4)[C@H]3CC[C@@]12C |
| InChI | InChI=1S/C22H32O2/c1-4-24-22-13-15(22)12-20-19-7-5-14-11-16(23-3)6-8-17(14)18(19)9-10-21(20,22)2/h6,15,18-20H,4-5,7-13H2,1-3H3/t15-,18+,19+,20-,21-,22-/m0/s1 |
| InChIKey | QPRCGILEVKPFHL-ZCHQJCHRSA-N |
| XLogP | 5.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|