C25H34O4 — CID 145361493
13'-ethyl-3'-methoxy-5,5-dimethylspiro[1,3-dioxane-2,17'-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene]-11'-one (PubChem CID 145361493) has the molecular formula C25H34O4 and a molecular weight of 398.54 g/mol. Its IUPAC name is 13'-ethyl-3'-methoxy-5,5-dimethylspiro[1,3-dioxane-2,17'-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene]-11'-one.
| Compound Name | 13'-ethyl-3'-methoxy-5,5-dimethylspiro[1,3-dioxane-2,17'-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene]-11'-one |
|---|---|
| PubChem CID | 145361493 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | 13'-ethyl-3'-methoxy-5,5-dimethylspiro[1,3-dioxane-2,17'-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene]-11'-one |
| SMILES | CCC12CC(=O)C3c4ccc(OC)cc4CCC3C1CCC21OCC(C)(C)CO1 |
| InChI | InChI=1S/C25H34O4/c1-5-24-13-21(26)22-18-9-7-17(27-4)12-16(18)6-8-19(22)20(24)10-11-25(24)28-14-23(2,3)15-29-25/h7,9,12,19-20,22H,5-6,8,10-11,13-15H2,1-4H3 |
| InChIKey | HLNLNKIVOBLUQG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |