C21H28O6 — CID 123863844
3'-methoxy-13'-methylspiro[1,3-dioxolane-2,17'-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene]-8',9',11'-triol (PubChem CID 123863844) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is 3'-methoxy-13'-methylspiro[1,3-dioxolane-2,17'-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene]-8',9',11'-triol.
| Compound Name | 3'-methoxy-13'-methylspiro[1,3-dioxolane-2,17'-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene]-8',9',11'-triol |
|---|---|
| PubChem CID | 123863844 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 3'-methoxy-13'-methylspiro[1,3-dioxolane-2,17'-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene]-8',9',11'-triol |
| SMILES | COc1ccc2c(c1)CCC1(O)C3CCC4(OCCO4)C3(C)CC(O)C21O |
| InChI | InChI=1S/C21H28O6/c1-18-12-17(22)21(24)15-4-3-14(25-2)11-13(15)5-7-19(21,23)16(18)6-8-20(18)26-9-10-27-20/h3-4,11,16-17,22-24H,5-10,12H2,1-2H3 |
| InChIKey | NORDFKAAPOGHIF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |