C25H30NO — CID 10672404
CID 10672404 (PubChem CID 10672404) has the molecular formula C25H30NO and a molecular weight of 360.52 g/mol.
| Compound Name | CID 10672404 |
|---|---|
| PubChem CID | 10672404 |
| Molecular Formula | C25H30NO |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | — |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)C[C@@H](/N=C/[C]3[CH][CH][CH][CH]3)C[C@@H]12 |
| InChI | InChI=1S/C25H30NO/c1-25-12-11-22-21-10-8-20(27-2)13-18(21)7-9-23(22)24(25)14-19(15-25)26-16-17-5-3-4-6-17/h3-6,8,10,13,16,19,22-24H,7,9,11-12,14-15H2,1-2H3/b26-16+/t19-,22+,23+,24-,25+/m0/s1 |
| InChIKey | YSLJFWCJRWHSCI-XFRMANEZSA-N |
| XLogP | 5.40 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|