C27H35N3O4 — CID 177015250
N-[3-(3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl)propyl]-6-methoxypyridazine-3-carboxamide (PubChem CID 177015250) has the molecular formula C27H35N3O4 and a molecular weight of 465.59 g/mol. Its IUPAC name is N-[3-(3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl)propyl]-6-methoxypyridazine-3-carboxamide.
| Compound Name | N-[3-(3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl)propyl]-6-methoxypyridazine-3-carboxamide |
|---|---|
| PubChem CID | 177015250 |
| Molecular Formula | C27H35N3O4 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | N-[3-(3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl)propyl]-6-methoxypyridazine-3-carboxamide |
| SMILES | COc1ccc(C(=O)NCCCC2Cc3cc(O)ccc3C3CCC4(C)C(O)CCC4C23)nn1 |
| InChI | InChI=1S/C27H35N3O4/c1-27-12-11-20-19-6-5-18(31)15-17(19)14-16(25(20)21(27)7-9-23(27)32)4-3-13-28-26(33)22-8-10-24(34-2)30-29-22/h5-6,8,10,15-16,20-21,23,25,31-32H,3-4,7,9,11-14H2,1-2H3,(H,28,33) |
| InChIKey | JGOVVMQXOVEXBU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|