C32H45N5O3 — CID 177015563
N-[3-(3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl)propyl]-6-[(4-methylpiperazin-1-yl)methyl]pyridazine-3-carboxamide (PubChem CID 177015563) has the molecular formula C32H45N5O3 and a molecular weight of 547.74 g/mol. Its IUPAC name is N-[3-(3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl)propyl]-6-[(4-methylpiperazin-1-yl)methyl]pyridazine-3-carboxamide.
| Compound Name | N-[3-(3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl)propyl]-6-[(4-methylpiperazin-1-yl)methyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 177015563 |
| Molecular Formula | C32H45N5O3 |
| Molecular Weight | 547.74 g/mol |
| Exact Mass | 547.35 |
| IUPAC Name | N-[3-(3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl)propyl]-6-[(4-methylpiperazin-1-yl)methyl]pyridazine-3-carboxamide |
| SMILES | CN1CCN(Cc2ccc(C(=O)NCCCC3Cc4cc(O)ccc4C4CCC5(C)C(O)CCC5C34)nn2)CC1 |
| InChI | InChI=1S/C32H45N5O3/c1-32-12-11-26-25-7-6-24(38)19-22(25)18-21(30(26)27(32)8-10-29(32)39)4-3-13-33-31(40)28-9-5-23(34-35-28)20-37-16-14-36(2)15-17-37/h5-7,9,19,21,26-27,29-30,38-39H,3-4,8,10-18,20H2,1-2H3,(H,33,40) |
| InChIKey | RDPUMUPYXMJFDL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.74 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|