C40H57F10NO3 — CID 10234337
11-fluoro-13,17-dimethyl-7-[5-[methyl(7,7,8,8,9,9,10,10,10-nonafluorodecyl)amino]pentyl]-3-(oxan-2-yloxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol (PubChem CID 10234337) has the molecular formula C40H57F10NO3 and a molecular weight of 789.88 g/mol. Its IUPAC name is 11-fluoro-13,17-dimethyl-7-[5-[methyl(7,7,8,8,9,9,10,10,10-nonafluorodecyl)amino]pentyl]-3-(oxan-2-yloxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | 11-fluoro-13,17-dimethyl-7-[5-[methyl(7,7,8,8,9,9,10,10,10-nonafluorodecyl)amino]pentyl]-3-(oxan-2-yloxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 10234337 |
| Molecular Formula | C40H57F10NO3 |
| Molecular Weight | 789.88 g/mol |
| Exact Mass | 789.42 |
| IUPAC Name | 11-fluoro-13,17-dimethyl-7-[5-[methyl(7,7,8,8,9,9,10,10,10-nonafluorodecyl)amino]pentyl]-3-(oxan-2-yloxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
| SMILES | CN(CCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCCCCC1Cc2cc(OC3CCCCO3)ccc2C2C(F)CC3(C)C(CCC3(C)O)C12 |
| InChI | InChI=1S/C40H57F10NO3/c1-35-25-31(41)34-29-16-15-28(54-32-14-8-12-22-53-32)24-27(29)23-26(33(34)30(35)17-19-36(35,2)52)13-7-6-11-21-51(3)20-10-5-4-9-18-37(42,43)38(44,45)39(46,47)40(48,49)50/h15-16,24,26,30-34,52H,4-14,17-23,25H2,1-3H3 |
| InChIKey | UTZVEZFUPRLDHF-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.88 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|