C33H53F2NO2 — CID 70997530
(11S,13S,17S)-11-fluoro-7-[5-[8-fluorooctyl(methyl)amino]pentyl]-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 70997530) has the molecular formula C33H53F2NO2 and a molecular weight of 533.79 g/mol. Its IUPAC name is (11S,13S,17S)-11-fluoro-7-[5-[8-fluorooctyl(methyl)amino]pentyl]-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (11S,13S,17S)-11-fluoro-7-[5-[8-fluorooctyl(methyl)amino]pentyl]-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 70997530 |
| Molecular Formula | C33H53F2NO2 |
| Molecular Weight | 533.79 g/mol |
| Exact Mass | 533.40 |
| IUPAC Name | (11S,13S,17S)-11-fluoro-7-[5-[8-fluorooctyl(methyl)amino]pentyl]-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CN(CCCCCCCCF)CCCCCC1Cc2cc(O)ccc2C2C1C1CC[C@](C)(O)[C@@]1(C)C[C@@H]2F |
| InChI | InChI=1S/C33H53F2NO2/c1-32-23-29(35)31-27-15-14-26(37)22-25(27)21-24(30(31)28(32)16-17-33(32,2)38)13-9-8-12-20-36(3)19-11-7-5-4-6-10-18-34/h14-15,22,24,28-31,37-38H,4-13,16-21,23H2,1-3H3/t24?,28?,29-,30?,31?,32-,33-/m0/s1 |
| InChIKey | YNPXQIMEAKXHGU-NGVGMNFRSA-N |
| XLogP | 7.98 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.79 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|