C33H52F3NO2 — CID 71000205
(11S,13S,17S)-7-[5-[8,8-difluorooctyl(methyl)amino]pentyl]-11-fluoro-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 71000205) has the molecular formula C33H52F3NO2 and a molecular weight of 551.78 g/mol. Its IUPAC name is (11S,13S,17S)-7-[5-[8,8-difluorooctyl(methyl)amino]pentyl]-11-fluoro-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (11S,13S,17S)-7-[5-[8,8-difluorooctyl(methyl)amino]pentyl]-11-fluoro-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 71000205 |
| Molecular Formula | C33H52F3NO2 |
| Molecular Weight | 551.78 g/mol |
| Exact Mass | 551.40 |
| IUPAC Name | (11S,13S,17S)-7-[5-[8,8-difluorooctyl(methyl)amino]pentyl]-11-fluoro-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CN(CCCCCCCC(F)F)CCCCCC1Cc2cc(O)ccc2C2C1C1CC[C@](C)(O)[C@@]1(C)C[C@@H]2F |
| InChI | InChI=1S/C33H52F3NO2/c1-32-22-28(34)31-26-15-14-25(38)21-24(26)20-23(30(31)27(32)16-17-33(32,2)39)12-8-7-11-19-37(3)18-10-6-4-5-9-13-29(35)36/h14-15,21,23,27-31,38-39H,4-13,16-20,22H2,1-3H3/t23?,27?,28-,30?,31?,32-,33-/m0/s1 |
| InChIKey | BDEXFCHOIGXCRO-VNRDEYEMSA-N |
| XLogP | 8.27 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.78 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|