C40H55FN2O3 — CID 90716443
4-cyano-N-[6-[(13S)-11-fluoro-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]hexyl]-N-octylbenzamide (PubChem CID 90716443) has the molecular formula C40H55FN2O3 and a molecular weight of 630.89 g/mol. Its IUPAC name is 4-cyano-N-[6-[(13S)-11-fluoro-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]hexyl]-N-octylbenzamide.
| Compound Name | 4-cyano-N-[6-[(13S)-11-fluoro-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]hexyl]-N-octylbenzamide |
|---|---|
| PubChem CID | 90716443 |
| Molecular Formula | C40H55FN2O3 |
| Molecular Weight | 630.89 g/mol |
| Exact Mass | 630.42 |
| IUPAC Name | 4-cyano-N-[6-[(13S)-11-fluoro-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]hexyl]-N-octylbenzamide |
| SMILES | CCCCCCCCN(CCCCCCC1Cc2cc(O)ccc2C2C(F)C[C@]3(C)C(O)CCC3C12)C(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C40H55FN2O3/c1-3-4-5-6-8-11-22-43(39(46)29-16-14-28(27-42)15-17-29)23-12-9-7-10-13-30-24-31-25-32(44)18-19-33(31)38-35(41)26-40(2)34(37(30)38)20-21-36(40)45/h14-19,25,30,34-38,44-45H,3-13,20-24,26H2,1-2H3/t30?,34?,35?,36?,37?,38?,40-/m0/s1 |
| InChIKey | NTICTAXZFOAWFO-ZXNRPIPYSA-N |
| XLogP | 9.11 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.89 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|