C41H61FNO5+ — CID 91560454
acetyl-(3,4-dimethoxyphenyl)-[5-[(13S)-11-fluoro-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]pentyl]-octylazanium (PubChem CID 91560454) has the molecular formula C41H61FNO5+ and a molecular weight of 666.94 g/mol. Its IUPAC name is acetyl-(3,4-dimethoxyphenyl)-[5-[(13S)-11-fluoro-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]pentyl]-octylazanium.
| Compound Name | acetyl-(3,4-dimethoxyphenyl)-[5-[(13S)-11-fluoro-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]pentyl]-octylazanium |
|---|---|
| PubChem CID | 91560454 |
| Molecular Formula | C41H61FNO5+ |
| Molecular Weight | 666.94 g/mol |
| Exact Mass | 666.45 |
| IUPAC Name | acetyl-(3,4-dimethoxyphenyl)-[5-[(13S)-11-fluoro-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]pentyl]-octylazanium |
| SMILES | CCCCCCCC[N+](CCCCCC1Cc2cc(O)ccc2C2C(F)C[C@]3(C)C(O)CCC3C12)(C(C)=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C41H60FNO5/c1-6-7-8-9-10-13-22-43(28(2)44,31-16-20-36(47-4)37(26-31)48-5)23-14-11-12-15-29-24-30-25-32(45)17-18-33(30)40-35(42)27-41(3)34(39(29)40)19-21-38(41)46/h16-18,20,25-26,29,34-35,38-40,46H,6-15,19,21-24,27H2,1-5H3/p+1/t29?,34?,35?,38?,39?,40?,41-,43?/m0/s1 |
| InChIKey | AIZTVCLIVLVYBY-NHUQVGJFSA-O |
| XLogP | 9.28 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.94 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|