C36H52ClF6NO2 — CID 75288875
4-chloro-11-fluoro-13,17-dimethyl-7-[5-[2-(7,7,8,8,8-pentafluorooctyl)pyrrolidin-1-yl]pentyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 75288875) has the molecular formula C36H52ClF6NO2 and a molecular weight of 680.26 g/mol. Its IUPAC name is 4-chloro-11-fluoro-13,17-dimethyl-7-[5-[2-(7,7,8,8,8-pentafluorooctyl)pyrrolidin-1-yl]pentyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | 4-chloro-11-fluoro-13,17-dimethyl-7-[5-[2-(7,7,8,8,8-pentafluorooctyl)pyrrolidin-1-yl]pentyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 75288875 |
| Molecular Formula | C36H52ClF6NO2 |
| Molecular Weight | 680.26 g/mol |
| Exact Mass | 679.36 |
| IUPAC Name | 4-chloro-11-fluoro-13,17-dimethyl-7-[5-[2-(7,7,8,8,8-pentafluorooctyl)pyrrolidin-1-yl]pentyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CC1(O)CCC2C3C(CCCCCN4CCCC4CCCCCCC(F)(F)C(F)(F)F)Cc4c(ccc(O)c4Cl)C3C(F)CC21C |
| InChI | InChI=1S/C36H52ClF6NO2/c1-33-22-28(38)31-25-14-15-29(45)32(37)26(25)21-23(30(31)27(33)16-18-34(33,2)46)11-6-5-9-19-44-20-10-13-24(44)12-7-3-4-8-17-35(39,40)36(41,42)43/h14-15,23-24,27-28,30-31,45-46H,3-13,16-22H2,1-2H3 |
| InChIKey | ZDQVSBKGMWYAHC-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.26 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|