C23H35O6P — CID 24749285
diethyl [(8R,9S,13S,14S,17S)-3-hydroxy-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] phosphate (PubChem CID 24749285) has the molecular formula C23H35O6P and a molecular weight of 438.50 g/mol. Its IUPAC name is diethyl [(8R,9S,13S,14S,17S)-3-hydroxy-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] phosphate.
| Compound Name | diethyl [(8R,9S,13S,14S,17S)-3-hydroxy-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] phosphate |
|---|---|
| PubChem CID | 24749285 |
| Molecular Formula | C23H35O6P |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | diethyl [(8R,9S,13S,14S,17S)-3-hydroxy-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] phosphate |
| SMILES | CCOP(=O)(OCC)O[C@H]1CC[C@H]2[C@@H]3CCc4cc(O)c(OC)cc4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H35O6P/c1-5-27-30(25,28-6-2)29-22-10-9-19-17-8-7-15-13-20(24)21(26-4)14-18(15)16(17)11-12-23(19,22)3/h13-14,16-17,19,22,24H,5-12H2,1-4H3/t16-,17+,19-,22-,23-/m0/s1 |
| InChIKey | FZVDUMLLFNWHEX-JIAAILLZSA-N |
| XLogP | 5.82 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|