C43H68BF2NO5S — CID 168918122
CID 168918122 (PubChem CID 168918122) has the molecular formula C43H68BF2NO5S and a molecular weight of 759.89 g/mol.
| Compound Name | CID 168918122 |
|---|---|
| PubChem CID | 168918122 |
| Molecular Formula | C43H68BF2NO5S |
| Molecular Weight | 759.89 g/mol |
| Exact Mass | 759.49 |
| IUPAC Name | — |
| SMILES | CC(=O)O.CC12CCC3c4ccc(N5CCC6(CCOCC6)CC5)cc4CCC3C1CC(F)C2=O.[B]C(C)(F)CCCCS(=O)C(C)(C)C(C)(C)CC |
| InChI | InChI=1S/C27H36FNO2.C14H28BFOS.C2H4O2/c1-26-7-6-21-20-5-3-19(29-12-8-27(9-13-29)10-14-31-15-11-27)16-18(20)2-4-22(21)23(26)17-24(28)25(26)30;1-7-12(2,3)13(4,5)18(17)11-9-8-10-14(6,15)16;1-2(3)4/h3,5,16,21-24H,2,4,6-15,17H2,1H3;7-11H2,1-6H3;1H3,(H,3,4) |
| InChIKey | SFGIDBBHSCXLOD-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.89 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|