About CID 156742680
CID 156742680 (PubChem CID 156742680) has the molecular formula C39H59BF4NO4PS
and a molecular weight of 755.75 g/mol.
Molecular Properties
| Compound Name | CID 156742680 |
| PubChem CID | 156742680 |
| Molecular Formula | C39H59BF4NO4PS |
| Molecular Weight | 755.75 g/mol |
| Exact Mass | 755.39 |
| IUPAC Name | — |
| SMILES | CC12CCC3c4ccc(OC(=O)N5CCC6(CCOCC6)CC5)cc4CCC3C1CCC2O.[B]C(F)(F)C(F)(F)CCCSP(C)C(C)(C)CC |
| InChI | InChI=1S/C28H39NO4.C11H20BF4PS/c1-27-9-8-22-21-5-3-20(18-19(21)2-4-23(22)24(27)6-7-25(27)30)33-26(31)29-14-10-28(11-15-29)12-16-32-17-13-28;1-5-9(2,3)17(4)18-8-6-7-10(13,14)11(12,15)16/h3,5,18,22-25,30H,2,4,6-17H2,1H3;5-8H2,1-4H3 |
| InChIKey | NHTUUAWUMKEEJD-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 755.75 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 156742680 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156742680?
The IUPAC name of CID 156742680 (CID 156742680) is not available.
What is the SMILES notation for CID 156742680?
The canonical SMILES for CID 156742680 is CC12CCC3c4ccc(OC(=O)N5CCC6(CCOCC6)CC5)cc4CCC3C1CCC2O.[B]C(F)(F)C(F)(F)CCCSP(C)C(C)(C)CC.
What is the InChIKey of CID 156742680?
The InChIKey is NHTUUAWUMKEEJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H39NO4.C11H20BF4PS/c1-27-9-8-22-21-5-3-20(18-19(21)2-4-23(22)24(27)6-7-25(27)30)33-26(31)29-14-10-28(11-15-29)12-16-32-17-13-28;1-5-9(2,3)17(4)18-8-6-7-10(13,14)11(12,15)16/h3,5,18,22-25,30H,2,4,6-17H2,1H3;5-8H2,1-4H3.
What are the key properties of CID 156742680?
CID 156742680 has a molecular weight of 755.75 g/mol, XLogP of 10.41, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156742680 is sourced from PubChem (CID 156742680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).