C39H59BF4NO4PS — CID 156742680
CID 156742680 (PubChem CID 156742680) has the molecular formula C39H59BF4NO4PS and a molecular weight of 755.75 g/mol.
| Compound Name | CID 156742680 |
|---|---|
| PubChem CID | 156742680 |
| Molecular Formula | C39H59BF4NO4PS |
| Molecular Weight | 755.75 g/mol |
| Exact Mass | 755.39 |
| IUPAC Name | — |
| SMILES | CC12CCC3c4ccc(OC(=O)N5CCC6(CCOCC6)CC5)cc4CCC3C1CCC2O.[B]C(F)(F)C(F)(F)CCCSP(C)C(C)(C)CC |
| InChI | InChI=1S/C28H39NO4.C11H20BF4PS/c1-27-9-8-22-21-5-3-20(18-19(21)2-4-23(22)24(27)6-7-25(27)30)33-26(31)29-14-10-28(11-15-29)12-16-32-17-13-28;1-5-9(2,3)17(4)18-8-6-7-10(13,14)11(12,15)16/h3,5,18,22-25,30H,2,4,6-17H2,1H3;5-8H2,1-4H3 |
| InChIKey | NHTUUAWUMKEEJD-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.75 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|