C37H55BF4N2O4S — CID 168918242
CID 168918242 (PubChem CID 168918242) has the molecular formula C37H55BF4N2O4S and a molecular weight of 710.73 g/mol.
| Compound Name | CID 168918242 |
|---|---|
| PubChem CID | 168918242 |
| Molecular Formula | C37H55BF4N2O4S |
| Molecular Weight | 710.73 g/mol |
| Exact Mass | 710.39 |
| IUPAC Name | — |
| SMILES | [B]C(F)(F)C(F)(F)CCCS(=O)C(C)(C)C(C)(C)CC.[H]/N=C1\CCC2C3CCc4cc(OC(=O)N5CCOC(C)C5)ccc4C3CCC12C |
| InChI | InChI=1S/C24H32N2O3.C13H23BF4OS/c1-15-14-26(11-12-28-15)23(27)29-17-4-6-18-16(13-17)3-5-20-19(18)9-10-24(2)21(20)7-8-22(24)25;1-6-10(2,3)11(4,5)20(19)9-7-8-12(15,16)13(14,17)18/h4,6,13,15,19-21,25H,3,5,7-12,14H2,1-2H3;6-9H2,1-5H3/b25-22+; |
| InChIKey | YKODLMHBARKFRM-OSMRDGEFSA-N |
| XLogP | 8.91 |
| TPSA | 79.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.73 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|