C25H32N2O3 — CID 168917989
(17-imino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) 1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole-5-carboxylate (PubChem CID 168917989) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is (17-imino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) 1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole-5-carboxylate.
| Compound Name | (17-imino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) 1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 168917989 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | (17-imino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) 1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole-5-carboxylate |
| SMILES | [H]/N=C1\CCC2C3CCc4cc(OC(=O)N5CC6COCC6C5)ccc4C3CCC12C |
| InChI | InChI=1S/C25H32N2O3/c1-25-9-8-20-19-5-3-18(30-24(28)27-11-16-13-29-14-17(16)12-27)10-15(19)2-4-21(20)22(25)6-7-23(25)26/h3,5,10,16-17,20-22,26H,2,4,6-9,11-14H2,1H3/b26-23+ |
| InChIKey | DMVCCXCPAJARDQ-WNAAXNPUSA-N |
| XLogP | 4.64 |
| TPSA | 62.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|