C23H33N3O2 — CID 168917871
(17-imino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) N-[2-(dimethylamino)ethyl]carbamate (PubChem CID 168917871) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is (17-imino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) N-[2-(dimethylamino)ethyl]carbamate.
| Compound Name | (17-imino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) N-[2-(dimethylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 168917871 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | (17-imino-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) N-[2-(dimethylamino)ethyl]carbamate |
| SMILES | [H]/N=C1\CCC2C3CCc4cc(OC(=O)NCCN(C)C)ccc4C3CCC12C |
| InChI | InChI=1S/C23H33N3O2/c1-23-11-10-18-17-7-5-16(28-22(27)25-12-13-26(2)3)14-15(17)4-6-19(18)20(23)8-9-21(23)24/h5,7,14,18-20,24H,4,6,8-13H2,1-3H3,(H,25,27)/b24-21+ |
| InChIKey | RIVZKBZQJMEPII-DARPEHSRSA-N |
| XLogP | 4.21 |
| TPSA | 65.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|