C39H58BF4NO4S — CID 168917723
CID 168917723 (PubChem CID 168917723) has the molecular formula C39H58BF4NO4S and a molecular weight of 723.77 g/mol.
| Compound Name | CID 168917723 |
|---|---|
| PubChem CID | 168917723 |
| Molecular Formula | C39H58BF4NO4S |
| Molecular Weight | 723.77 g/mol |
| Exact Mass | 723.41 |
| IUPAC Name | — |
| SMILES | CCC(C)(C)CC.CCc1cc2c(cc1OC(=O)N1C3CCC1COC3)CCC1C2CCC2(C)C(=O)CCC12.[B]C(F)(F)C(F)(F)CCCS |
| InChI | InChI=1S/C27H35NO4.C7H16.C5H7BF4S/c1-3-16-12-22-17(4-7-21-20(22)10-11-27(2)23(21)8-9-25(27)29)13-24(16)32-26(30)28-18-5-6-19(28)15-31-14-18;1-5-7(3,4)6-2;6-5(9,10)4(7,8)2-1-3-11/h12-13,18-21,23H,3-11,14-15H2,1-2H3;5-6H2,1-4H3;11H,1-3H2 |
| InChIKey | BXYOMJHVSISOPB-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 55.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.77 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|