C24H33NO3 — CID 53322480
N,N-diethyl-2-[(8R,9S,13S,14S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl]acetamide (PubChem CID 53322480) has the molecular formula C24H33NO3 and a molecular weight of 383.53 g/mol. Its IUPAC name is N,N-diethyl-2-[(8R,9S,13S,14S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl]acetamide.
| Compound Name | N,N-diethyl-2-[(8R,9S,13S,14S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl]acetamide |
|---|---|
| PubChem CID | 53322480 |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | N,N-diethyl-2-[(8R,9S,13S,14S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl]acetamide |
| SMILES | CCN(CC)C(=O)CC1C[C@H]2[C@@H]3CCc4cc(O)ccc4[C@H]3CC[C@]2(C)C1=O |
| InChI | InChI=1S/C24H33NO3/c1-4-25(5-2)22(27)14-16-13-21-20-8-6-15-12-17(26)7-9-18(15)19(20)10-11-24(21,3)23(16)28/h7,9,12,16,19-21,26H,4-6,8,10-11,13-14H2,1-3H3/t16?,19-,20-,21+,24+/m1/s1 |
| InChIKey | NUYXZZNRVPOMFS-FDHCNUOYSA-N |
| XLogP | 4.30 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |