C22H26O5 — CID 90930207
ethyl 2-[(13S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl]-2-oxoacetate (PubChem CID 90930207) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is ethyl 2-[(13S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[(13S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 90930207 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | ethyl 2-[(13S)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-16-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)C1CC2C3CCc4cc(O)ccc4C3CC[C@]2(C)C1=O |
| InChI | InChI=1S/C22H26O5/c1-3-27-21(26)19(24)17-11-18-16-6-4-12-10-13(23)5-7-14(12)15(16)8-9-22(18,2)20(17)25/h5,7,10,15-18,23H,3-4,6,8-9,11H2,1-2H3/t15?,16?,17?,18?,22-/m0/s1 |
| InChIKey | OADCRZRJPCBTGP-KOPPYVOFSA-N |
| XLogP | 3.18 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|