C30H39F3O3Si — CID 11284004
[(8R,9S,13S,14S,17S)-2-methoxy-13-methyl-3-phenylmethoxy-17-(trifluoromethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane (PubChem CID 11284004) has the molecular formula C30H39F3O3Si and a molecular weight of 532.72 g/mol. Its IUPAC name is [(8R,9S,13S,14S,17S)-2-methoxy-13-methyl-3-phenylmethoxy-17-(trifluoromethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane.
| Compound Name | [(8R,9S,13S,14S,17S)-2-methoxy-13-methyl-3-phenylmethoxy-17-(trifluoromethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 11284004 |
| Molecular Formula | C30H39F3O3Si |
| Molecular Weight | 532.72 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | [(8R,9S,13S,14S,17S)-2-methoxy-13-methyl-3-phenylmethoxy-17-(trifluoromethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane |
| SMILES | COc1cc2c(cc1OCc1ccccc1)CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(O[Si](C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C30H39F3O3Si/c1-28-15-13-22-23(25(28)14-16-29(28,30(31,32)33)36-37(3,4)5)12-11-21-17-27(26(34-2)18-24(21)22)35-19-20-9-7-6-8-10-20/h6-10,17-18,22-23,25H,11-16,19H2,1-5H3/t22-,23+,25-,28-,29-/m0/s1 |
| InChIKey | DGNVEMVYQLBQAK-IZYVUOEASA-N |
| XLogP | 8.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.72 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|