C25H37NO4Si — CID 25095574
(8R,9S,13S,14S,17S)-2-methoxy-3-(methoxymethoxy)-13-methyl-17-trimethylsilyloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carbonitrile (PubChem CID 25095574) has the molecular formula C25H37NO4Si and a molecular weight of 443.66 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-2-methoxy-3-(methoxymethoxy)-13-methyl-17-trimethylsilyloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carbonitrile.
| Compound Name | (8R,9S,13S,14S,17S)-2-methoxy-3-(methoxymethoxy)-13-methyl-17-trimethylsilyloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carbonitrile |
|---|---|
| PubChem CID | 25095574 |
| Molecular Formula | C25H37NO4Si |
| Molecular Weight | 443.66 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | (8R,9S,13S,14S,17S)-2-methoxy-3-(methoxymethoxy)-13-methyl-17-trimethylsilyloxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carbonitrile |
| SMILES | COCOc1cc2c(cc1OC)[C@H]1CC[C@@]3(C)[C@@H](CC[C@]3(C#N)O[Si](C)(C)C)[C@@H]1CC2 |
| InChI | InChI=1S/C25H37NO4Si/c1-24-11-9-18-19(21(24)10-12-25(24,15-26)30-31(4,5)6)8-7-17-13-23(29-16-27-2)22(28-3)14-20(17)18/h13-14,18-19,21H,7-12,16H2,1-6H3/t18-,19+,21-,24-,25+/m0/s1 |
| InChIKey | DITWRAYEWSOPLH-WICNZQTKSA-N |
| XLogP | 5.65 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.66 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|