C27H34O3 — CID 58741298
(13S,17R)-17-benzylperoxy-2-methoxy-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 58741298) has the molecular formula C27H34O3 and a molecular weight of 406.57 g/mol. Its IUPAC name is (13S,17R)-17-benzylperoxy-2-methoxy-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (13S,17R)-17-benzylperoxy-2-methoxy-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 58741298 |
| Molecular Formula | C27H34O3 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | (13S,17R)-17-benzylperoxy-2-methoxy-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | COc1cc2c(cc1C)CCC1C2CC[C@@]2(C)C1CC[C@H]2OOCc1ccccc1 |
| InChI | InChI=1S/C27H34O3/c1-18-15-20-9-10-22-21(23(20)16-25(18)28-3)13-14-27(2)24(22)11-12-26(27)30-29-17-19-7-5-4-6-8-19/h4-8,15-16,21-22,24,26H,9-14,17H2,1-3H3/t21?,22?,24?,26-,27+/m1/s1 |
| InChIKey | IBOXQAYBZAHLFR-WFDRBNDASA-N |
| XLogP | 6.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|