C25H34N2O4S — CID 25172193
[(8S,9S,13R,14S,17R)-2-ethyl-13-methyl-17-[(3-methyl-1,2-oxazol-5-yl)methyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] sulfamate (PubChem CID 25172193) has the molecular formula C25H34N2O4S and a molecular weight of 458.62 g/mol. Its IUPAC name is [(8S,9S,13R,14S,17R)-2-ethyl-13-methyl-17-[(3-methyl-1,2-oxazol-5-yl)methyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] sulfamate.
| Compound Name | [(8S,9S,13R,14S,17R)-2-ethyl-13-methyl-17-[(3-methyl-1,2-oxazol-5-yl)methyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] sulfamate |
|---|---|
| PubChem CID | 25172193 |
| Molecular Formula | C25H34N2O4S |
| Molecular Weight | 458.62 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | [(8S,9S,13R,14S,17R)-2-ethyl-13-methyl-17-[(3-methyl-1,2-oxazol-5-yl)methyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] sulfamate |
| SMILES | CCc1cc2c(cc1OS(N)(=O)=O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](Cc3cc(C)no3)CC[C@@H]12 |
| InChI | InChI=1S/C25H34N2O4S/c1-4-16-12-22-17(13-24(16)31-32(26,28)29)5-7-21-20(22)9-10-25(3)18(6-8-23(21)25)14-19-11-15(2)27-30-19/h11-13,18,20-21,23H,4-10,14H2,1-3H3,(H2,26,28,29)/t18-,20+,21-,23+,25-/m1/s1 |
| InChIKey | IOIPLFXOOOJORW-GZSZSNQWSA-N |
| XLogP | 4.84 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.62 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |