C18H20INO3 — CID 54229094
[(8R,9S,13S,14S)-2-iodo-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] nitrite (PubChem CID 54229094) has the molecular formula C18H20INO3 and a molecular weight of 425.27 g/mol. Its IUPAC name is [(8R,9S,13S,14S)-2-iodo-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] nitrite.
| Compound Name | [(8R,9S,13S,14S)-2-iodo-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] nitrite |
|---|---|
| PubChem CID | 54229094 |
| Molecular Formula | C18H20INO3 |
| Molecular Weight | 425.27 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | [(8R,9S,13S,14S)-2-iodo-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] nitrite |
| SMILES | C[C@]12CC[C@@H]3c4cc(I)c(ON=O)cc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C18H20INO3/c1-18-7-6-11-12(14(18)4-5-17(18)21)3-2-10-8-16(23-20-22)15(19)9-13(10)11/h8-9,11-12,14H,2-7H2,1H3/t11-,12+,14-,18-/m0/s1 |
| InChIKey | QHYHNNAUUVYHCW-JPVZDGGYSA-N |
| XLogP | 4.78 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.27 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|