C19H24O6S — CID 70614584
[(8R,9S,13S,14S)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl] hydrogen sulfate (PubChem CID 70614584) has the molecular formula C19H24O6S and a molecular weight of 380.46 g/mol. Its IUPAC name is [(8R,9S,13S,14S)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl] hydrogen sulfate.
| Compound Name | [(8R,9S,13S,14S)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 70614584 |
| Molecular Formula | C19H24O6S |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | [(8R,9S,13S,14S)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl] hydrogen sulfate |
| SMILES | COc1cc2c(c(OS(=O)(=O)O)c1)[C@H]1CC[C@]3(C)C(=O)CC[C@H]3[C@@H]1CC2 |
| InChI | InChI=1S/C19H24O6S/c1-19-8-7-14-13(15(19)5-6-17(19)20)4-3-11-9-12(24-2)10-16(18(11)14)25-26(21,22)23/h9-10,13-15H,3-8H2,1-2H3,(H,21,22,23)/t13-,14+,15+,19+/m1/s1 |
| InChIKey | DAMSFCNIGMGMSK-QZNHQWIBSA-N |
| XLogP | 3.30 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|