C32H34O7S2 — CID 88845956
[(8S,9S,13S,14S)-13-methyl-1-(4-methylphenyl)sulfonyloxy-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate (PubChem CID 88845956) has the molecular formula C32H34O7S2 and a molecular weight of 594.75 g/mol. Its IUPAC name is [(8S,9S,13S,14S)-13-methyl-1-(4-methylphenyl)sulfonyloxy-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(8S,9S,13S,14S)-13-methyl-1-(4-methylphenyl)sulfonyloxy-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 88845956 |
| Molecular Formula | C32H34O7S2 |
| Molecular Weight | 594.75 g/mol |
| Exact Mass | 594.17 |
| IUPAC Name | [(8S,9S,13S,14S)-13-methyl-1-(4-methylphenyl)sulfonyloxy-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cc3c(c(OS(=O)(=O)c4ccc(C)cc4)c2)[C@H]2CC[C@]4(C)C(=O)CC[C@H]4[C@H]2CC3)cc1 |
| InChI | InChI=1S/C32H34O7S2/c1-20-4-9-24(10-5-20)40(34,35)38-23-18-22-8-13-26-27(16-17-32(3)28(26)14-15-30(32)33)31(22)29(19-23)39-41(36,37)25-11-6-21(2)7-12-25/h4-7,9-12,18-19,26-28H,8,13-17H2,1-3H3/t26-,27-,28-,32-/m0/s1 |
| InChIKey | QCBKCCPHRVFAKS-OAJQQGRKSA-N |
| XLogP | 6.26 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.75 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|