C27H31NO2S — CID 163201553
(8R,9S,13S,14S)-13-methyl-3-[(E)-2-[(4-methylphenyl)sulfonimidoyl]ethenyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 163201553) has the molecular formula C27H31NO2S and a molecular weight of 433.62 g/mol. Its IUPAC name is (8R,9S,13S,14S)-13-methyl-3-[(E)-2-[(4-methylphenyl)sulfonimidoyl]ethenyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-13-methyl-3-[(E)-2-[(4-methylphenyl)sulfonimidoyl]ethenyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 163201553 |
| Molecular Formula | C27H31NO2S |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | (8R,9S,13S,14S)-13-methyl-3-[(E)-2-[(4-methylphenyl)sulfonimidoyl]ethenyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | [H]N=S(=O)(/C=C/c1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H31NO2S/c1-18-3-7-21(8-4-18)31(28,30)16-14-19-5-9-22-20(17-19)6-10-24-23(22)13-15-27(2)25(24)11-12-26(27)29/h3-5,7-9,14,16-17,23-25,28H,6,10-13,15H2,1-2H3/b16-14+/t23-,24-,25+,27+,31?/m1/s1 |
| InChIKey | OTOSZOYTFXTXAY-PXGSVBGTSA-N |
| XLogP | 6.50 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |