C24H36NO2Si — CID 69334403
CID 69334403 (PubChem CID 69334403) has the molecular formula C24H36NO2Si and a molecular weight of 398.64 g/mol.
| Compound Name | CID 69334403 |
|---|---|
| PubChem CID | 69334403 |
| Molecular Formula | C24H36NO2Si |
| Molecular Weight | 398.64 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | — |
| SMILES | C[Si](C)Oc1c(N)c(C(C)(C)C)cc2c1[C@H]1CC[C@]3(C)C(=O)CC[C@H]3[C@@H]1CC2 |
| InChI | InChI=1S/C24H36NO2Si/c1-23(2,3)18-13-14-7-8-15-16(20(14)22(21(18)25)27-28(5)6)11-12-24(4)17(15)9-10-19(24)26/h13,15-17H,7-12,25H2,1-6H3/t15-,16+,17+,24+/m1/s1 |
| InChIKey | NUUQBRMAFZZTLN-WDGNKJTDSA-N |
| XLogP | 5.62 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.64 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|