C24H34NO2Si — CID 69334412
CID 69334412 (PubChem CID 69334412) has the molecular formula C24H34NO2Si and a molecular weight of 396.63 g/mol.
| Compound Name | CID 69334412 |
|---|---|
| PubChem CID | 69334412 |
| Molecular Formula | C24H34NO2Si |
| Molecular Weight | 396.63 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc2c(cc1N)[C@H]1CC[C@]3(C(C)(C)O[Si])C(=O)CC[C@H]3[C@@H]1CC2 |
| InChI | InChI=1S/C24H34NO2Si/c1-22(2,3)19-12-14-6-7-16-15(17(14)13-20(19)25)10-11-24(23(4,5)27-28)18(16)8-9-21(24)26/h12-13,15-16,18H,6-11,25H2,1-5H3/t15-,16+,18-,24+/m0/s1 |
| InChIKey | KIUMUDVYOAIRTG-ANXRINLSSA-N |
| XLogP | 4.85 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.63 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|