C24H31ClO4 — CID 70614585
[(8R,9S,13S,14S,16R)-3-butoxy-16-chloro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl] acetate (PubChem CID 70614585) has the molecular formula C24H31ClO4 and a molecular weight of 418.96 g/mol. Its IUPAC name is [(8R,9S,13S,14S,16R)-3-butoxy-16-chloro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl] acetate.
| Compound Name | [(8R,9S,13S,14S,16R)-3-butoxy-16-chloro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl] acetate |
|---|---|
| PubChem CID | 70614585 |
| Molecular Formula | C24H31ClO4 |
| Molecular Weight | 418.96 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | [(8R,9S,13S,14S,16R)-3-butoxy-16-chloro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-yl] acetate |
| SMILES | CCCCOc1cc2c(c(OC(C)=O)c1)[C@H]1CC[C@]3(C)C(=O)[C@H](Cl)C[C@H]3[C@@H]1CC2 |
| InChI | InChI=1S/C24H31ClO4/c1-4-5-10-28-16-11-15-6-7-17-18(22(15)21(12-16)29-14(2)26)8-9-24(3)19(17)13-20(25)23(24)27/h11-12,17-20H,4-10,13H2,1-3H3/t17-,18+,19+,20-,24+/m1/s1 |
| InChIKey | MLYSWPGTCVEEDW-AYNNDYFXSA-N |
| XLogP | 5.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.96 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|