C25H32O6 — CID 22789102
[(1R,2S,4R,8S,9S,12S)-14-acetyloxy-6,6,9-trimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-13(18),14,16-trien-16-yl] acetate (PubChem CID 22789102) has the molecular formula C25H32O6 and a molecular weight of 428.53 g/mol. Its IUPAC name is [(1R,2S,4R,8S,9S,12S)-14-acetyloxy-6,6,9-trimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-13(18),14,16-trien-16-yl] acetate.
| Compound Name | [(1R,2S,4R,8S,9S,12S)-14-acetyloxy-6,6,9-trimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-13(18),14,16-trien-16-yl] acetate |
|---|---|
| PubChem CID | 22789102 |
| Molecular Formula | C25H32O6 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | [(1R,2S,4R,8S,9S,12S)-14-acetyloxy-6,6,9-trimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-13(18),14,16-trien-16-yl] acetate |
| SMILES | CC(=O)Oc1cc2c(c(OC(C)=O)c1)[C@H]1CC[C@]3(C)[C@@H]4OC(C)(C)O[C@@H]4C[C@H]3[C@H]1CC2 |
| InChI | InChI=1S/C25H32O6/c1-13(26)28-16-10-15-6-7-17-18(22(15)20(11-16)29-14(2)27)8-9-25(5)19(17)12-21-23(25)31-24(3,4)30-21/h10-11,17-19,21,23H,6-9,12H2,1-5H3/t17-,18-,19-,21+,23+,25-/m0/s1 |
| InChIKey | JOHRLGSVVWFHCD-PZMICJGSSA-N |
| XLogP | 4.52 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|