C25H36O4 — CID 70614557
[(8S,9S,13S,14S,17S)-17-hydroxy-13-methyl-3-propoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-yl] butanoate (PubChem CID 70614557) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is [(8S,9S,13S,14S,17S)-17-hydroxy-13-methyl-3-propoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-yl] butanoate.
| Compound Name | [(8S,9S,13S,14S,17S)-17-hydroxy-13-methyl-3-propoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-yl] butanoate |
|---|---|
| PubChem CID | 70614557 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | [(8S,9S,13S,14S,17S)-17-hydroxy-13-methyl-3-propoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-yl] butanoate |
| SMILES | CCCOc1cc2c(c(OC(=O)CCC)c1)[C@H]1CC[C@]3(C)[C@@H](O)CC[C@H]3[C@@H]1CC2 |
| InChI | InChI=1S/C25H36O4/c1-4-6-23(27)29-21-15-17(28-13-5-2)14-16-7-8-18-19(24(16)21)11-12-25(3)20(18)9-10-22(25)26/h14-15,18-20,22,26H,4-13H2,1-3H3/t18-,19+,20+,22+,25+/m1/s1 |
| InChIKey | YRZFOFABRMOJEI-OHRHNVSXSA-N |
| XLogP | 5.40 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|