C32H45NO6S — CID 58587610
1-O-[2-(4,4-dimethyl-1-nitrososulfanylcyclohexyl)ethyl] 4-O-[(8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] butanedioate (PubChem CID 58587610) has the molecular formula C32H45NO6S and a molecular weight of 571.78 g/mol. Its IUPAC name is 1-O-[2-(4,4-dimethyl-1-nitrososulfanylcyclohexyl)ethyl] 4-O-[(8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] butanedioate.
| Compound Name | 1-O-[2-(4,4-dimethyl-1-nitrososulfanylcyclohexyl)ethyl] 4-O-[(8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] butanedioate |
|---|---|
| PubChem CID | 58587610 |
| Molecular Formula | C32H45NO6S |
| Molecular Weight | 571.78 g/mol |
| Exact Mass | 571.30 |
| IUPAC Name | 1-O-[2-(4,4-dimethyl-1-nitrososulfanylcyclohexyl)ethyl] 4-O-[(8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] butanedioate |
| SMILES | CC1(C)CCC(CCOC(=O)CCC(=O)Oc2ccc3c(c2)CC[C@@H]2[C@@H]3CC[C@]3(C)[C@@H](O)CC[C@@H]23)(SN=O)CC1 |
| InChI | InChI=1S/C32H45NO6S/c1-30(2)14-16-32(17-15-30,40-33-37)18-19-38-28(35)10-11-29(36)39-22-5-7-23-21(20-22)4-6-25-24(23)12-13-31(3)26(25)8-9-27(31)34/h5,7,20,24-27,34H,4,6,8-19H2,1-3H3/t24-,25-,26+,27+,31+/m1/s1 |
| InChIKey | SJJQHKKDDPXCSL-MKOCCIKRSA-N |
| XLogP | 7.28 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.78 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|