C27H27F3O3S — CID 138969446
[(8S,9S,13S,14S)-17-(4-ethenylphenyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate (PubChem CID 138969446) has the molecular formula C27H27F3O3S and a molecular weight of 488.57 g/mol. Its IUPAC name is [(8S,9S,13S,14S)-17-(4-ethenylphenyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate.
| Compound Name | [(8S,9S,13S,14S)-17-(4-ethenylphenyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 138969446 |
| Molecular Formula | C27H27F3O3S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | [(8S,9S,13S,14S)-17-(4-ethenylphenyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate |
| SMILES | C=Cc1ccc(C2=CC[C@H]3[C@@H]4CCc5cc(OS(=O)(=O)C(F)(F)F)ccc5[C@H]4CC[C@]23C)cc1 |
| InChI | InChI=1S/C27H27F3O3S/c1-3-17-4-6-18(7-5-17)24-12-13-25-23-10-8-19-16-20(33-34(31,32)27(28,29)30)9-11-21(19)22(23)14-15-26(24,25)2/h3-7,9,11-12,16,22-23,25H,1,8,10,13-15H2,2H3/t22-,23-,25+,26-/m1/s1 |
| InChIKey | DURWUYCQRHXXPD-VHCQPULKSA-N |
| XLogP | 7.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|