C24H32O3 — CID 67689189
5-[(13S,14R,17S)-17-hydroxy-13-methyl-15-methylidene-7,8,9,11,12,14,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]pentanoic acid (PubChem CID 67689189) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is 5-[(13S,14R,17S)-17-hydroxy-13-methyl-15-methylidene-7,8,9,11,12,14,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]pentanoic acid.
| Compound Name | 5-[(13S,14R,17S)-17-hydroxy-13-methyl-15-methylidene-7,8,9,11,12,14,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 67689189 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 5-[(13S,14R,17S)-17-hydroxy-13-methyl-15-methylidene-7,8,9,11,12,14,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]pentanoic acid |
| SMILES | C=C1C[C@H](O)[C@@]2(C)CCC3c4ccc(CCCCC(=O)O)cc4CCC3[C@H]12 |
| InChI | InChI=1S/C24H32O3/c1-15-13-21(25)24(2)12-11-19-18-9-7-16(5-3-4-6-22(26)27)14-17(18)8-10-20(19)23(15)24/h7,9,14,19-21,23,25H,1,3-6,8,10-13H2,2H3,(H,26,27)/t19?,20?,21-,23-,24+/m0/s1 |
| InChIKey | IISKSZCGZMGDMS-UAZQFCIXSA-N |
| XLogP | 4.87 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|