C18H20O4 — CID 154289934
(8R,9S,13S,14S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,17-octahydrocyclopenta[a]phenanthrene-15,16-dione (PubChem CID 154289934) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is (8R,9S,13S,14S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,17-octahydrocyclopenta[a]phenanthrene-15,16-dione.
| Compound Name | (8R,9S,13S,14S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,17-octahydrocyclopenta[a]phenanthrene-15,16-dione |
|---|---|
| PubChem CID | 154289934 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (8R,9S,13S,14S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,17-octahydrocyclopenta[a]phenanthrene-15,16-dione |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1C(=O)C(=O)C2O |
| InChI | InChI=1S/C18H20O4/c1-18-7-6-12-11-5-3-10(19)8-9(11)2-4-13(12)14(18)15(20)16(21)17(18)22/h3,5,8,12-14,17,19,22H,2,4,6-7H2,1H3/t12-,13-,14-,17?,18+/m1/s1 |
| InChIKey | FEPWSWWXZZQSAS-DEZYCOFESA-N |
| XLogP | 1.97 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|