C21H29NO5S — CID 87154190
[(6R,8R,9S,13S,14S,17E)-17-hydroxyimino-6-(methoxymethyl)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] methanesulfonate (PubChem CID 87154190) has the molecular formula C21H29NO5S and a molecular weight of 407.53 g/mol. Its IUPAC name is [(6R,8R,9S,13S,14S,17E)-17-hydroxyimino-6-(methoxymethyl)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] methanesulfonate.
| Compound Name | [(6R,8R,9S,13S,14S,17E)-17-hydroxyimino-6-(methoxymethyl)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 87154190 |
| Molecular Formula | C21H29NO5S |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | [(6R,8R,9S,13S,14S,17E)-17-hydroxyimino-6-(methoxymethyl)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] methanesulfonate |
| SMILES | COC[C@@H]1C[C@@H]2[C@H](CC[C@]3(C)/C(=N/O)CC[C@@H]23)c2ccc(OS(C)(=O)=O)cc21 |
| InChI | InChI=1S/C21H29NO5S/c1-21-9-8-16-15-5-4-14(27-28(3,24)25)11-17(15)13(12-26-2)10-18(16)19(21)6-7-20(21)22-23/h4-5,11,13,16,18-19,23H,6-10,12H2,1-3H3/b22-20+/t13-,16+,18+,19-,21-/m0/s1 |
| InChIKey | FVUAVRGVSXTYOC-FQDKJSSOSA-N |
| XLogP | 3.90 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|