C23H26N2O — CID 58636516
(2Z)-2-[(8S,9S,13S,14S)-2-ethyl-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]-2-isocyanoacetonitrile (PubChem CID 58636516) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is (2Z)-2-[(8S,9S,13S,14S)-2-ethyl-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2Z)-2-[(8S,9S,13S,14S)-2-ethyl-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 58636516 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (2Z)-2-[(8S,9S,13S,14S)-2-ethyl-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1/CC[C@H]2[C@@H]3CCc4cc(O)c(CC)cc4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H26N2O/c1-4-14-11-18-15(12-22(14)26)5-6-17-16(18)9-10-23(2)19(17)7-8-20(23)21(13-24)25-3/h11-12,16-17,19,26H,4-10H2,1-2H3/b21-20-/t16-,17+,19-,23-/m0/s1 |
| InChIKey | XAERKDAKFOWDBL-GDMZQXMHSA-N |
| XLogP | 5.51 |
| TPSA | 48.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|