C28H36O3 — CID 70187645
(8R,9S,13S,14S,17R)-2-[(4-hydroxy-3,5-dimethylphenyl)methyl]-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 70187645) has the molecular formula C28H36O3 and a molecular weight of 420.59 g/mol. Its IUPAC name is (8R,9S,13S,14S,17R)-2-[(4-hydroxy-3,5-dimethylphenyl)methyl]-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9S,13S,14S,17R)-2-[(4-hydroxy-3,5-dimethylphenyl)methyl]-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 70187645 |
| Molecular Formula | C28H36O3 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | (8R,9S,13S,14S,17R)-2-[(4-hydroxy-3,5-dimethylphenyl)methyl]-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | COc1cc2c(cc1Cc1cc(C)c(O)c(C)c1)[C@H]1CC[C@]3(C)[C@H](O)CC[C@H]3[C@@H]1CC2 |
| InChI | InChI=1S/C28H36O3/c1-16-11-18(12-17(2)27(16)30)13-20-14-23-19(15-25(20)31-4)5-6-22-21(23)9-10-28(3)24(22)7-8-26(28)29/h11-12,14-15,21-22,24,26,29-30H,5-10,13H2,1-4H3/t21-,22+,24-,26+,28-/m0/s1 |
| InChIKey | NHCPANLWDHVVED-KRDYGAQZSA-N |
| XLogP | 5.83 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |